C24H31NO4 — CID 91710093
2-O-octyl 6-O-(3-phenylpropyl) pyridine-2,6-dicarboxylate (PubChem CID 91710093) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-O-octyl 6-O-(3-phenylpropyl) pyridine-2,6-dicarboxylate.
| Compound Name | 2-O-octyl 6-O-(3-phenylpropyl) pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 91710093 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-O-octyl 6-O-(3-phenylpropyl) pyridine-2,6-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)c1cccc(C(=O)OCCCc2ccccc2)n1 |
| InChI | InChI=1S/C24H31NO4/c1-2-3-4-5-6-10-18-28-23(26)21-16-11-17-22(25-21)24(27)29-19-12-15-20-13-8-7-9-14-20/h7-9,11,13-14,16-17H,2-6,10,12,15,18-19H2,1H3 |
| InChIKey | FUCFFBUTSKYAES-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|