C21H33NO4 — CID 91724902
6-O-(2,2-dimethylpropyl) 2-O-nonyl pyridine-2,6-dicarboxylate (PubChem CID 91724902) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 6-O-(2,2-dimethylpropyl) 2-O-nonyl pyridine-2,6-dicarboxylate.
| Compound Name | 6-O-(2,2-dimethylpropyl) 2-O-nonyl pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 91724902 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 6-O-(2,2-dimethylpropyl) 2-O-nonyl pyridine-2,6-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)c1cccc(C(=O)OCC(C)(C)C)n1 |
| InChI | InChI=1S/C21H33NO4/c1-5-6-7-8-9-10-11-15-25-19(23)17-13-12-14-18(22-17)20(24)26-16-21(2,3)4/h12-14H,5-11,15-16H2,1-4H3 |
| InChIKey | LOHRXFIPFBWNLJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|