C19H29NO4 — CID 91712367
6-O-(2,2-dimethylpropyl) 2-O-heptyl pyridine-2,6-dicarboxylate (PubChem CID 91712367) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 6-O-(2,2-dimethylpropyl) 2-O-heptyl pyridine-2,6-dicarboxylate.
| Compound Name | 6-O-(2,2-dimethylpropyl) 2-O-heptyl pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 91712367 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 6-O-(2,2-dimethylpropyl) 2-O-heptyl pyridine-2,6-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1cccc(C(=O)OCC(C)(C)C)n1 |
| InChI | InChI=1S/C19H29NO4/c1-5-6-7-8-9-13-23-17(21)15-11-10-12-16(20-15)18(22)24-14-19(2,3)4/h10-12H,5-9,13-14H2,1-4H3 |
| InChIKey | DQUBKWQWKZHKTH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|