C22H35NO4 — CID 91724958
6-O-(2-ethylbutyl) 2-O-nonyl pyridine-2,6-dicarboxylate (PubChem CID 91724958) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is 6-O-(2-ethylbutyl) 2-O-nonyl pyridine-2,6-dicarboxylate.
| Compound Name | 6-O-(2-ethylbutyl) 2-O-nonyl pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 91724958 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 6-O-(2-ethylbutyl) 2-O-nonyl pyridine-2,6-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)c1cccc(C(=O)OCC(CC)CC)n1 |
| InChI | InChI=1S/C22H35NO4/c1-4-7-8-9-10-11-12-16-26-21(24)19-14-13-15-20(23-19)22(25)27-17-18(5-2)6-3/h13-15,18H,4-12,16-17H2,1-3H3 |
| InChIKey | QKWLVLHRHNYSCG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|