C14H15NO3S — CID 137320111
ethyl 2-(phenylmethoxymethyl)-1,3-thiazole-4-carboxylate (PubChem CID 137320111) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is ethyl 2-(phenylmethoxymethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(phenylmethoxymethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 137320111 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | ethyl 2-(phenylmethoxymethyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(COCc2ccccc2)n1 |
| InChI | InChI=1S/C14H15NO3S/c1-2-18-14(16)12-10-19-13(15-12)9-17-8-11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3 |
| InChIKey | QGGNFUMGEONQDR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |