C10H10Cl3NO5S — CID 10594849
ethyl 2-(2,2,2-trichloroethoxycarbonyloxymethyl)-1,3-thiazole-4-carboxylate (PubChem CID 10594849) has the molecular formula C10H10Cl3NO5S and a molecular weight of 362.62 g/mol. Its IUPAC name is ethyl 2-(2,2,2-trichloroethoxycarbonyloxymethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(2,2,2-trichloroethoxycarbonyloxymethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 10594849 |
| Molecular Formula | C10H10Cl3NO5S |
| Molecular Weight | 362.62 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | ethyl 2-(2,2,2-trichloroethoxycarbonyloxymethyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(COC(=O)OCC(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C10H10Cl3NO5S/c1-2-17-8(15)6-4-20-7(14-6)3-18-9(16)19-5-10(11,12)13/h4H,2-3,5H2,1H3 |
| InChIKey | XFOMBEWOZZBURU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|