C8H6NO2RbS — CID 59110522
ethyl 2-ethynyl-1,3-thiazole-4-carboxylate;rubidium(1+) (PubChem CID 59110522) has the molecular formula C8H6NO2RbS and a molecular weight of 265.68 g/mol. Its IUPAC name is ethyl 2-ethynyl-1,3-thiazole-4-carboxylate;rubidium(1+).
| Compound Name | ethyl 2-ethynyl-1,3-thiazole-4-carboxylate;rubidium(1+) |
|---|---|
| PubChem CID | 59110522 |
| Molecular Formula | C8H6NO2RbS |
| Molecular Weight | 265.68 g/mol |
| Exact Mass | 264.92 |
| IUPAC Name | ethyl 2-ethynyl-1,3-thiazole-4-carboxylate;rubidium(1+) |
| SMILES | [C-]#Cc1nc(C(=O)OCC)cs1.[Rb+] |
| InChI | InChI=1S/C8H6NO2S.Rb/c1-3-7-9-6(5-12-7)8(10)11-4-2;/h5H,4H2,2H3;/q-1;+1 |
| InChIKey | PSVLLCLHOAYNFR-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.68 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|