About 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate
2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate (PubChem CID 71987431) has the molecular formula C12H19NO3S
and a molecular weight of 257.35 g/mol. Its IUPAC name is 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate.
Analyze 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate (CID 71987431) is 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate is CCC(C)(C)COC(=O)c1csc(COC)n1.
What is the InChIKey of 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate?
The InChIKey is VGCLFDGRSYSFAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3S/c1-5-12(2,3)8-16-11(14)9-7-17-10(13-9)6-15-4/h7H,5-6,8H2,1-4H3.
What are the key properties of 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate?
2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate has a molecular weight of 257.35 g/mol, XLogP of 2.88, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 71987431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).