C14H19NO3S — CID 95086991
[(1R,6S)-6-methylcyclohex-3-en-1-yl]methyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate (PubChem CID 95086991) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is [(1R,6S)-6-methylcyclohex-3-en-1-yl]methyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | [(1R,6S)-6-methylcyclohex-3-en-1-yl]methyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 95086991 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [(1R,6S)-6-methylcyclohex-3-en-1-yl]methyl 2-(methoxymethyl)-1,3-thiazole-4-carboxylate |
| SMILES | COCc1nc(C(=O)OC[C@@H]2CC=CC[C@@H]2C)cs1 |
| InChI | InChI=1S/C14H19NO3S/c1-10-5-3-4-6-11(10)7-18-14(16)12-9-19-13(15-12)8-17-2/h3-4,9-11H,5-8H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | ZJUGVEITKLLLQC-QWRGUYRKSA-N |
| XLogP | 3.05 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|