C14H18N2O3S — CID 94221380
[(1R,6R)-6-methylcyclohex-3-en-1-yl]methyl 2-acetamido-1,3-thiazole-4-carboxylate (PubChem CID 94221380) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is [(1R,6R)-6-methylcyclohex-3-en-1-yl]methyl 2-acetamido-1,3-thiazole-4-carboxylate.
| Compound Name | [(1R,6R)-6-methylcyclohex-3-en-1-yl]methyl 2-acetamido-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 94221380 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [(1R,6R)-6-methylcyclohex-3-en-1-yl]methyl 2-acetamido-1,3-thiazole-4-carboxylate |
| SMILES | CC(=O)Nc1nc(C(=O)OC[C@@H]2CC=CC[C@H]2C)cs1 |
| InChI | InChI=1S/C14H18N2O3S/c1-9-5-3-4-6-11(9)7-19-13(18)12-8-20-14(16-12)15-10(2)17/h3-4,8-9,11H,5-7H2,1-2H3,(H,15,16,17)/t9-,11+/m1/s1 |
| InChIKey | LXHTYOIPEYZBAV-KOLCDFICSA-N |
| XLogP | 2.86 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|