C13H19N3O2S — CID 94164490
2-acetamido-N-[(1S,2R)-2-methylcyclohexyl]-1,3-thiazole-4-carboxamide (PubChem CID 94164490) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-acetamido-N-[(1S,2R)-2-methylcyclohexyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-acetamido-N-[(1S,2R)-2-methylcyclohexyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 94164490 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-acetamido-N-[(1S,2R)-2-methylcyclohexyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)Nc1nc(C(=O)N[C@H]2CCCC[C@H]2C)cs1 |
| InChI | InChI=1S/C13H19N3O2S/c1-8-5-3-4-6-10(8)15-12(18)11-7-19-13(16-11)14-9(2)17/h7-8,10H,3-6H2,1-2H3,(H,15,18)(H,14,16,17)/t8-,10+/m1/s1 |
| InChIKey | AFGDQZYAURNHPA-SCZZXKLOSA-N |
| XLogP | 2.41 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |