C12H16N2O3S — CID 116696629
2-[(2-methylcyclohexyl)carbamoyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 116696629) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-[(2-methylcyclohexyl)carbamoyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(2-methylcyclohexyl)carbamoyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116696629 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-[(2-methylcyclohexyl)carbamoyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1CCCCC1NC(=O)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H16N2O3S/c1-7-4-2-3-5-8(7)13-10(15)11-14-9(6-18-11)12(16)17/h6-8H,2-5H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | DLJLYNZZEXVVLP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |