About 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide
4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide (PubChem CID 130611628) has the molecular formula C9H12N2OS
and a molecular weight of 196.27 g/mol. Its IUPAC name is 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 130611628 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1csc(C(=O)NC2CC2C)n1 |
| InChI | InChI=1S/C9H12N2OS/c1-5-3-7(5)11-8(12)9-10-6(2)4-13-9/h4-5,7H,3H2,1-2H3,(H,11,12) |
| InChIKey | SXHWRBGBBSEODE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide?
The IUPAC name of 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide (CID 130611628) is 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide is Cc1csc(C(=O)NC2CC2C)n1.
What is the InChIKey of 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide?
The InChIKey is SXHWRBGBBSEODE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-5-3-7(5)11-8(12)9-10-6(2)4-13-9/h4-5,7H,3H2,1-2H3,(H,11,12).
What are the key properties of 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide?
4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide has a molecular weight of 196.27 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(2-methylcyclopropyl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 130611628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).