C10H9N3OS — CID 110696243
4-methyl-N-pyridin-2-yl-1,3-thiazole-2-carboxamide (PubChem CID 110696243) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is 4-methyl-N-pyridin-2-yl-1,3-thiazole-2-carboxamide.
| Compound Name | 4-methyl-N-pyridin-2-yl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 110696243 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 4-methyl-N-pyridin-2-yl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2ccccn2)n1 |
| InChI | InChI=1S/C10H9N3OS/c1-7-6-15-10(12-7)9(14)13-8-4-2-3-5-11-8/h2-6H,1H3,(H,11,13,14) |
| InChIKey | IIUKDGGALHEKIW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |