C22H32N2O2 — CID 124805645
1-N,4-N-bis[(1S,2R)-2-methylcyclohexyl]benzene-1,4-dicarboxamide (PubChem CID 124805645) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-N,4-N-bis[(1S,2R)-2-methylcyclohexyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(1S,2R)-2-methylcyclohexyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 124805645 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 1-N,4-N-bis[(1S,2R)-2-methylcyclohexyl]benzene-1,4-dicarboxamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)c1ccc(C(=O)N[C@H]2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C22H32N2O2/c1-15-7-3-5-9-19(15)23-21(25)17-11-13-18(14-12-17)22(26)24-20-10-6-4-8-16(20)2/h11-16,19-20H,3-10H2,1-2H3,(H,23,25)(H,24,26)/t15-,16-,19+,20+/m1/s1 |
| InChIKey | MVTUQUDYXZAYQX-YKCBXCCJSA-N |
| XLogP | 4.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |