C14H21N3O — CID 61090027
3,5-diamino-N-(2-methylcyclohexyl)benzamide (PubChem CID 61090027) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 3,5-diamino-N-(2-methylcyclohexyl)benzamide.
| Compound Name | 3,5-diamino-N-(2-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 61090027 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 3,5-diamino-N-(2-methylcyclohexyl)benzamide |
| SMILES | CC1CCCCC1NC(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C14H21N3O/c1-9-4-2-3-5-13(9)17-14(18)10-6-11(15)8-12(16)7-10/h6-9,13H,2-5,15-16H2,1H3,(H,17,18) |
| InChIKey | NDUTVOWSNJGONC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|