C15H21NOS — CID 8624319
N-[(1S,2S)-2-methylcyclohexyl]-4-methylsulfanylbenzamide (PubChem CID 8624319) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclohexyl]-4-methylsulfanylbenzamide.
| Compound Name | N-[(1S,2S)-2-methylcyclohexyl]-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 8624319 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclohexyl]-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)N[C@H]2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C15H21NOS/c1-11-5-3-4-6-14(11)16-15(17)12-7-9-13(18-2)10-8-12/h7-11,14H,3-6H2,1-2H3,(H,16,17)/t11-,14-/m0/s1 |
| InChIKey | ZJCSLUSNLZYZLM-FZMZJTMJSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |