C14H20N2O — CID 31825212
6-methyl-N-[(1R,2R)-2-methylcyclohexyl]pyridine-2-carboxamide (PubChem CID 31825212) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 6-methyl-N-[(1R,2R)-2-methylcyclohexyl]pyridine-2-carboxamide.
| Compound Name | 6-methyl-N-[(1R,2R)-2-methylcyclohexyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 31825212 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 6-methyl-N-[(1R,2R)-2-methylcyclohexyl]pyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)N[C@@H]2CCCC[C@H]2C)n1 |
| InChI | InChI=1S/C14H20N2O/c1-10-6-3-4-8-12(10)16-14(17)13-9-5-7-11(2)15-13/h5,7,9-10,12H,3-4,6,8H2,1-2H3,(H,16,17)/t10-,12-/m1/s1 |
| InChIKey | TXRSGYURZUTBES-ZYHUDNBSSA-N |
| XLogP | 2.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |