C11H15N3O4S — CID 94824310
2-acetamido-N-[(2R)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide (PubChem CID 94824310) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-acetamido-N-[(2R)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide.
| Compound Name | 2-acetamido-N-[(2R)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 94824310 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-acetamido-N-[(2R)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)Nc1nc(C(=O)NO[C@@H]2CCCCO2)cs1 |
| InChI | InChI=1S/C11H15N3O4S/c1-7(15)12-11-13-8(6-19-11)10(16)14-18-9-4-2-3-5-17-9/h6,9H,2-5H2,1H3,(H,14,16)(H,12,13,15)/t9-/m1/s1 |
| InChIKey | HVUAPQNQGMMTTM-SECBINFHSA-N |
| XLogP | 1.29 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|