C15H15ClN2O3S — CID 95174222
2-(2-chlorophenyl)-N-[(2R)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide (PubChem CID 95174222) has the molecular formula C15H15ClN2O3S and a molecular weight of 338.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[(2R)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[(2R)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 95174222 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[(2R)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NO[C@@H]1CCCCO1)c1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H15ClN2O3S/c16-11-6-2-1-5-10(11)15-17-12(9-22-15)14(19)18-21-13-7-3-4-8-20-13/h1-2,5-6,9,13H,3-4,7-8H2,(H,18,19)/t13-/m1/s1 |
| InChIKey | LNOJIMKDFXRVTD-CYBMUJFWSA-N |
| XLogP | 3.65 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|