C17H20ClN3OS — CID 119556621
2-(2-chlorophenyl)-N-(2-piperidin-3-ylethyl)-1,3-thiazole-4-carboxamide (PubChem CID 119556621) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(2-piperidin-3-ylethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-(2-piperidin-3-ylethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119556621 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(2-piperidin-3-ylethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCC1CCCNC1)c1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C17H20ClN3OS/c18-14-6-2-1-5-13(14)17-21-15(11-23-17)16(22)20-9-7-12-4-3-8-19-10-12/h1-2,5-6,11-12,19H,3-4,7-10H2,(H,20,22) |
| InChIKey | NFGTZVWUAMQLCA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |