C21H29ClN4O — CID 119555330
1-tert-butyl-3-(2-chlorophenyl)-N-(2-piperidin-3-ylethyl)pyrazole-4-carboxamide (PubChem CID 119555330) has the molecular formula C21H29ClN4O and a molecular weight of 388.94 g/mol. Its IUPAC name is 1-tert-butyl-3-(2-chlorophenyl)-N-(2-piperidin-3-ylethyl)pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-3-(2-chlorophenyl)-N-(2-piperidin-3-ylethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 119555330 |
| Molecular Formula | C21H29ClN4O |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-tert-butyl-3-(2-chlorophenyl)-N-(2-piperidin-3-ylethyl)pyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1cc(C(=O)NCCC2CCCNC2)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C21H29ClN4O/c1-21(2,3)26-14-17(19(25-26)16-8-4-5-9-18(16)22)20(27)24-12-10-15-7-6-11-23-13-15/h4-5,8-9,14-15,23H,6-7,10-13H2,1-3H3,(H,24,27) |
| InChIKey | ANUIMCCPIDULIS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |