C16H16N2O5S — CID 95305807
2-(1,3-benzodioxol-5-yl)-N-[(2S)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide (PubChem CID 95305807) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(2S)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(2S)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 95305807 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(2S)-oxan-2-yl]oxy-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NO[C@H]1CCCCO1)c1csc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C16H16N2O5S/c19-15(18-23-14-3-1-2-6-20-14)11-8-24-16(17-11)10-4-5-12-13(7-10)22-9-21-12/h4-5,7-8,14H,1-3,6,9H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | KPECQBSKFJASQA-AWEZNQCLSA-N |
| XLogP | 2.73 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|