C13H19N3O5S — CID 154753101
ethyl 2-[2-(oxan-2-yloxycarbamoylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 154753101) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is ethyl 2-[2-(oxan-2-yloxycarbamoylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(oxan-2-yloxycarbamoylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 154753101 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | ethyl 2-[2-(oxan-2-yloxycarbamoylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)NOC2CCCCO2)n1 |
| InChI | InChI=1S/C13H19N3O5S/c1-2-19-10(17)7-9-8-22-13(14-9)15-12(18)16-21-11-5-3-4-6-20-11/h8,11H,2-7H2,1H3,(H2,14,15,16,18) |
| InChIKey | WVZRQCLANLEACC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|