C15H11N3O5S — CID 46605544
(1,3-dioxoisoindol-2-yl)methyl 2-acetamido-1,3-thiazole-4-carboxylate (PubChem CID 46605544) has the molecular formula C15H11N3O5S and a molecular weight of 345.34 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-acetamido-1,3-thiazole-4-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-acetamido-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 46605544 |
| Molecular Formula | C15H11N3O5S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-acetamido-1,3-thiazole-4-carboxylate |
| SMILES | CC(=O)Nc1nc(C(=O)OCN2C(=O)c3ccccc3C2=O)cs1 |
| InChI | InChI=1S/C15H11N3O5S/c1-8(19)16-15-17-11(6-24-15)14(22)23-7-18-12(20)9-4-2-3-5-10(9)13(18)21/h2-6H,7H2,1H3,(H,16,17,19) |
| InChIKey | ZNVIIDRQDRBQHE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|