C17H15N3O5S — CID 51146422
ethyl 2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]-1,3-thiazole-4-carboxylate (PubChem CID 51146422) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 51146422 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | ethyl 2-[2-(1,3-dioxoisoindol-2-yl)propanoylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)C(C)N2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C17H15N3O5S/c1-3-25-16(24)12-8-26-17(18-12)19-13(21)9(2)20-14(22)10-6-4-5-7-11(10)15(20)23/h4-9H,3H2,1-2H3,(H,18,19,21) |
| InChIKey | CNQAQDGSNSXQQE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|