C16H13N5O3S — CID 108763094
2-(1,3-dioxoisoindol-2-yl)-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)propanamide (PubChem CID 108763094) has the molecular formula C16H13N5O3S and a molecular weight of 355.38 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)propanamide |
|---|---|
| PubChem CID | 108763094 |
| Molecular Formula | C16H13N5O3S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)propanamide |
| SMILES | Cc1csc2nc(NC(=O)C(C)N3C(=O)c4ccccc4C3=O)nn12 |
| InChI | InChI=1S/C16H13N5O3S/c1-8-7-25-16-18-15(19-21(8)16)17-12(22)9(2)20-13(23)10-5-3-4-6-11(10)14(20)24/h3-7,9H,1-2H3,(H,17,19,22) |
| InChIKey | QUNFSXZSAIMJNL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|