C18H16N6O3 — CID 92717081
(2R)-N-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 92717081) has the molecular formula C18H16N6O3 and a molecular weight of 364.37 g/mol. Its IUPAC name is (2R)-N-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2R)-N-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 92717081 |
| Molecular Formula | C18H16N6O3 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (2R)-N-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1cc(C)n2nc(NC(=O)[C@@H](C)N3C(=O)c4ccccc4C3=O)nc2n1 |
| InChI | InChI=1S/C18H16N6O3/c1-9-8-10(2)24-18(19-9)21-17(22-24)20-14(25)11(3)23-15(26)12-6-4-5-7-13(12)16(23)27/h4-8,11H,1-3H3,(H,20,22,25)/t11-/m1/s1 |
| InChIKey | OUBNHXGXFGKPEQ-LLVKDONJSA-N |
| XLogP | 1.36 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|