C29H26N6O3 — CID 122286825
(2S)-2-(1,3-dioxoisoindol-2-yl)-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]propanamide (PubChem CID 122286825) has the molecular formula C29H26N6O3 and a molecular weight of 506.57 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]propanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 122286825 |
| Molecular Formula | C29H26N6O3 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]propanamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(Nc3ccc(NC(=O)[C@H](C)N4C(=O)c5ccccc5C4=O)cc3)n2)cc1 |
| InChI | InChI=1S/C29H26N6O3/c1-17-8-10-20(11-9-17)31-25-16-18(2)30-29(34-25)33-22-14-12-21(13-15-22)32-26(36)19(3)35-27(37)23-6-4-5-7-24(23)28(35)38/h4-16,19H,1-3H3,(H,32,36)(H2,30,31,33,34)/t19-/m0/s1 |
| InChIKey | SLTXIOMCUYRNJK-IBGZPJMESA-N |
| XLogP | 5.20 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|