C29H25N5O — CID 18566649
N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]naphthalene-2-carboxamide (PubChem CID 18566649) has the molecular formula C29H25N5O and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18566649 |
| Molecular Formula | C29H25N5O |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]naphthalene-2-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(Nc3ccc(NC(=O)c4ccc5ccccc5c4)cc3)n2)cc1 |
| InChI | InChI=1S/C29H25N5O/c1-19-7-11-24(12-8-19)31-27-17-20(2)30-29(34-27)33-26-15-13-25(14-16-26)32-28(35)23-10-9-21-5-3-4-6-22(21)18-23/h3-18H,1-2H3,(H,32,35)(H2,30,31,33,34) |
| InChIKey | QLDRPEMMRFLTME-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |