C28H29N5O2 — CID 27621694
N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-4-butoxybenzamide (PubChem CID 27621694) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-4-butoxybenzamide.
| Compound Name | N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 27621694 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(Nc3nc(C)cc(Nc4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C28H29N5O2/c1-3-4-18-35-25-16-10-21(11-17-25)27(34)31-23-12-14-24(15-13-23)32-28-29-20(2)19-26(33-28)30-22-8-6-5-7-9-22/h5-17,19H,3-4,18H2,1-2H3,(H,31,34)(H2,29,30,32,33) |
| InChIKey | NABNFXOUYAILCB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|