C26H25N5O2 — CID 122287304
N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-4-phenoxybenzamide (PubChem CID 122287304) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-4-phenoxybenzamide.
| Compound Name | N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 122287304 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-4-phenoxybenzamide |
| SMILES | Cc1cc(N(C)C)nc(Nc2ccc(NC(=O)c3ccc(Oc4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C26H25N5O2/c1-18-17-24(31(2)3)30-26(27-18)29-21-13-11-20(12-14-21)28-25(32)19-9-15-23(16-10-19)33-22-7-5-4-6-8-22/h4-17H,1-3H3,(H,28,32)(H,27,29,30) |
| InChIKey | XEPXWZLZVYTZEA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |