C31H27N5O2 — CID 122296113
N-[4-[[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-phenoxybenzamide (PubChem CID 122296113) has the molecular formula C31H27N5O2 and a molecular weight of 501.59 g/mol. Its IUPAC name is N-[4-[[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-phenoxybenzamide.
| Compound Name | N-[4-[[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 122296113 |
| Molecular Formula | C31H27N5O2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-[4-[[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-4-phenoxybenzamide |
| SMILES | Cc1ccc(Nc2nc(C)cc(Nc3ccc(NC(=O)c4ccc(Oc5ccccc5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C31H27N5O2/c1-21-8-12-26(13-9-21)35-31-32-22(2)20-29(36-31)33-24-14-16-25(17-15-24)34-30(37)23-10-18-28(19-11-23)38-27-6-4-3-5-7-27/h3-20H,1-2H3,(H,34,37)(H2,32,33,35,36) |
| InChIKey | YNNULSICVDMWOB-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |