C26H25N5O2 — CID 44826839
3-methoxy-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]benzamide (PubChem CID 44826839) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-methoxy-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]benzamide.
| Compound Name | 3-methoxy-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 44826839 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-methoxy-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(Nc3nc(C)cc(Nc4ccc(C)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C26H25N5O2/c1-17-7-9-20(10-8-17)28-24-15-18(2)27-26(31-24)30-22-13-11-21(12-14-22)29-25(32)19-5-4-6-23(16-19)33-3/h4-16H,1-3H3,(H,29,32)(H2,27,28,30,31) |
| InChIKey | YPIUBOHUFWZAPC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |