C23H27N5O2 — CID 122296586
N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-methoxybenzamide (PubChem CID 122296586) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-methoxybenzamide.
| Compound Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 122296586 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-methoxybenzamide |
| SMILES | CCN(CC)c1cc(Nc2ccc(NC(=O)c3cccc(OC)c3)cc2)nc(C)n1 |
| InChI | InChI=1S/C23H27N5O2/c1-5-28(6-2)22-15-21(24-16(3)25-22)26-18-10-12-19(13-11-18)27-23(29)17-8-7-9-20(14-17)30-4/h7-15H,5-6H2,1-4H3,(H,27,29)(H,24,25,26) |
| InChIKey | XFZUOFKLHIVNFV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |