C23H24N6O — CID 122296778
4-cyano-N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]benzamide (PubChem CID 122296778) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 4-cyano-N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]benzamide.
| Compound Name | 4-cyano-N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 122296778 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 4-cyano-N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]benzamide |
| SMILES | CCN(CC)c1cc(Nc2ccc(NC(=O)c3ccc(C#N)cc3)cc2)nc(C)n1 |
| InChI | InChI=1S/C23H24N6O/c1-4-29(5-2)22-14-21(25-16(3)26-22)27-19-10-12-20(13-11-19)28-23(30)18-8-6-17(15-24)7-9-18/h6-14H,4-5H2,1-3H3,(H,28,30)(H,25,26,27) |
| InChIKey | KVCQWMONMJYYOY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |