C22H26N6O — CID 122296681
1-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-phenylurea (PubChem CID 122296681) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 122296681 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-phenylurea |
| SMILES | CCN(CC)c1cc(Nc2ccc(NC(=O)Nc3ccccc3)cc2)nc(C)n1 |
| InChI | InChI=1S/C22H26N6O/c1-4-28(5-2)21-15-20(23-16(3)24-21)25-18-11-13-19(14-12-18)27-22(29)26-17-9-7-6-8-10-17/h6-15H,4-5H2,1-3H3,(H,23,24,25)(H2,26,27,29) |
| InChIKey | VZTLVZDARPPUSH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |