C24H29N5O2 — CID 122296624
N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2-phenoxypropanamide (PubChem CID 122296624) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2-phenoxypropanamide.
| Compound Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2-phenoxypropanamide |
|---|---|
| PubChem CID | 122296624 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2-phenoxypropanamide |
| SMILES | CCN(CC)c1cc(Nc2ccc(NC(=O)C(C)Oc3ccccc3)cc2)nc(C)n1 |
| InChI | InChI=1S/C24H29N5O2/c1-5-29(6-2)23-16-22(25-18(4)26-23)27-19-12-14-20(15-13-19)28-24(30)17(3)31-21-10-8-7-9-11-21/h7-17H,5-6H2,1-4H3,(H,28,30)(H,25,26,27) |
| InChIKey | DGYNTQPKJQKKKK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |