C24H30N6O2 — CID 122296675
1-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(2-ethoxyphenyl)urea (PubChem CID 122296675) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(2-ethoxyphenyl)urea.
| Compound Name | 1-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(2-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 122296675 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(2-ethoxyphenyl)urea |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(Nc2cc(N(CC)CC)nc(C)n2)cc1 |
| InChI | InChI=1S/C24H30N6O2/c1-5-30(6-2)23-16-22(25-17(4)26-23)27-18-12-14-19(15-13-18)28-24(31)29-20-10-8-9-11-21(20)32-7-3/h8-16H,5-7H2,1-4H3,(H,25,26,27)(H2,28,29,31) |
| InChIKey | ZPGJDSPEQJLSBK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |