C27H28N6O2 — CID 122297608
1-(2-ethoxyphenyl)-3-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]urea (PubChem CID 122297608) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]urea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 122297608 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]urea |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(Nc2cc(Nc3ccc(C)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C27H28N6O2/c1-4-35-24-8-6-5-7-23(24)33-27(34)32-22-15-13-21(14-16-22)31-26-17-25(28-19(3)29-26)30-20-11-9-18(2)10-12-20/h5-17H,4H2,1-3H3,(H2,32,33,34)(H2,28,29,30,31) |
| InChIKey | KPCQXMMHSNAQSL-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |