C27H28N6O3 — CID 122286971
1-(2-ethoxyphenyl)-3-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]urea (PubChem CID 122286971) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]urea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 122286971 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]urea |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(Nc2nc(C)cc(Nc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C27H28N6O3/c1-4-36-24-8-6-5-7-23(24)32-27(34)31-21-11-9-20(10-12-21)30-26-28-18(2)17-25(33-26)29-19-13-15-22(35-3)16-14-19/h5-17H,4H2,1-3H3,(H2,31,32,34)(H2,28,29,30,33) |
| InChIKey | ZMPLJPMBKSTOQO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |