C25H24N6O — CID 18566756
1-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]-3-phenylurea (PubChem CID 18566756) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 18566756 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]-3-phenylurea |
| SMILES | Cc1ccc(Nc2cc(C)nc(Nc3ccc(NC(=O)Nc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C25H24N6O/c1-17-8-10-20(11-9-17)27-23-16-18(2)26-24(31-23)28-21-12-14-22(15-13-21)30-25(32)29-19-6-4-3-5-7-19/h3-16H,1-2H3,(H2,29,30,32)(H2,26,27,28,31) |
| InChIKey | NVFJQAJQTMYXRB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |