C24H20FN5O — CID 121032203
N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-fluorobenzamide (PubChem CID 121032203) has the molecular formula C24H20FN5O and a molecular weight of 413.46 g/mol. Its IUPAC name is N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 121032203 |
| Molecular Formula | C24H20FN5O |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-fluorobenzamide |
| SMILES | Cc1cc(Nc2ccccc2)nc(Nc2ccc(NC(=O)c3ccccc3F)cc2)n1 |
| InChI | InChI=1S/C24H20FN5O/c1-16-15-22(27-17-7-3-2-4-8-17)30-24(26-16)29-19-13-11-18(12-14-19)28-23(31)20-9-5-6-10-21(20)25/h2-15H,1H3,(H,28,31)(H2,26,27,29,30) |
| InChIKey | HBGWFQFSLOCPDW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |