C25H22N6O4 — CID 121032274
N-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]-2-nitrobenzamide (PubChem CID 121032274) has the molecular formula C25H22N6O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is N-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]-2-nitrobenzamide.
| Compound Name | N-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 121032274 |
| Molecular Formula | C25H22N6O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]-2-nitrobenzamide |
| SMILES | COc1ccc(Nc2cc(C)nc(Nc3ccc(NC(=O)c4ccccc4[N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C25H22N6O4/c1-16-15-23(27-17-11-13-20(35-2)14-12-17)30-25(26-16)29-19-9-7-18(8-10-19)28-24(32)21-5-3-4-6-22(21)31(33)34/h3-15H,1-2H3,(H,28,32)(H2,26,27,29,30) |
| InChIKey | ZSSKFZDIVNENJG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|