C25H23N5O — CID 121032199
N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-methylbenzamide (PubChem CID 121032199) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-methylbenzamide.
| Compound Name | N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 121032199 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-methylbenzamide |
| SMILES | Cc1cc(Nc2ccccc2)nc(Nc2ccc(NC(=O)c3ccccc3C)cc2)n1 |
| InChI | InChI=1S/C25H23N5O/c1-17-8-6-7-11-22(17)24(31)28-20-12-14-21(15-13-20)29-25-26-18(2)16-23(30-25)27-19-9-4-3-5-10-19/h3-16H,1-2H3,(H,28,31)(H2,26,27,29,30) |
| InChIKey | XHYXOHDGOFRBKS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |