C21H23ClN6O2 — CID 121075626
1-(2-chlorophenyl)-3-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]urea (PubChem CID 121075626) has the molecular formula C21H23ClN6O2 and a molecular weight of 426.91 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121075626 |
| Molecular Formula | C21H23ClN6O2 |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]urea |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)Nc3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C21H23ClN6O2/c1-14-13-19(26-15-7-9-16(30-2)10-8-15)28-20(25-14)23-11-12-24-21(29)27-18-6-4-3-5-17(18)22/h3-10,13H,11-12H2,1-2H3,(H2,24,27,29)(H2,23,25,26,28) |
| InChIKey | HKFMSLNRUHULOY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|