C22H24F2N6O3 — CID 122294586
1-[3-(difluoromethoxy)phenyl]-3-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]urea (PubChem CID 122294586) has the molecular formula C22H24F2N6O3 and a molecular weight of 458.47 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122294586 |
| Molecular Formula | C22H24F2N6O3 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]urea |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)Nc3cccc(OC(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C22H24F2N6O3/c1-14-12-19(28-15-6-8-17(32-2)9-7-15)30-21(27-14)25-10-11-26-22(31)29-16-4-3-5-18(13-16)33-20(23)24/h3-9,12-13,20H,10-11H2,1-2H3,(H2,26,29,31)(H2,25,27,28,30) |
| InChIKey | VBTXSPRFUNGTQI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|