C23H28N6O3 — CID 122325232
1-(3,4-dimethoxyphenyl)-3-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]urea (PubChem CID 122325232) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122325232 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCNc2nc(C)cc(Nc3ccc(C)cc3)n2)cc1OC |
| InChI | InChI=1S/C23H28N6O3/c1-15-5-7-17(8-6-15)27-21-13-16(2)26-22(29-21)24-11-12-25-23(30)28-18-9-10-19(31-3)20(14-18)32-4/h5-10,13-14H,11-12H2,1-4H3,(H2,25,28,30)(H2,24,26,27,29) |
| InChIKey | FYVCWMREVUBZJT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|