C23H27N5O3 — CID 122324842
2,3-dimethoxy-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 122324842) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122324842 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2,3-dimethoxy-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCNc2nc(C)cc(Nc3ccc(C)cc3)n2)c1OC |
| InChI | InChI=1S/C23H27N5O3/c1-15-8-10-17(11-9-15)27-20-14-16(2)26-23(28-20)25-13-12-24-22(29)18-6-5-7-19(30-3)21(18)31-4/h5-11,14H,12-13H2,1-4H3,(H,24,29)(H2,25,26,27,28) |
| InChIKey | WJGGTERJGJZZIS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|