C19H19Cl2N5OS — CID 122325148
2,5-dichloro-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]thiophene-3-carboxamide (PubChem CID 122325148) has the molecular formula C19H19Cl2N5OS and a molecular weight of 436.37 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 122325148 |
| Molecular Formula | C19H19Cl2N5OS |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 2,5-dichloro-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]thiophene-3-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCCNC(=O)c3cc(Cl)sc3Cl)n2)cc1 |
| InChI | InChI=1S/C19H19Cl2N5OS/c1-11-3-5-13(6-4-11)25-16-9-12(2)24-19(26-16)23-8-7-22-18(27)14-10-15(20)28-17(14)21/h3-6,9-10H,7-8H2,1-2H3,(H,22,27)(H2,23,24,25,26) |
| InChIKey | GUKIIGJDRKMXHV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|